C17H26F3N5O5S — CID 155839361
N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155839361) has the molecular formula C17H26F3N5O5S and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839361 |
| Molecular Formula | C17H26F3N5O5S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)NC[C@H]1CO[C@@H]2CN(c3cc(N(C)C)ncn3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O3S.C2HF3O2/c1-4-24(21,22)18-6-11-9-23-13-8-20(7-12(11)13)15-5-14(19(2)3)16-10-17-15;3-2(4,5)1(6)7/h5,10-13,18H,4,6-9H2,1-3H3;(H,6,7)/t11-,12+,13+;/m0./s1 |
| InChIKey | OEFDDFPKDFKXIY-LUHWTZLKSA-N |
| XLogP | 0.57 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |