C18H27N5O2 — CID 124818969
N-[[(3S,3aR,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-cyclopropylacetamide (PubChem CID 124818969) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[[(3S,3aR,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-cyclopropylacetamide.
| Compound Name | N-[[(3S,3aR,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-cyclopropylacetamide |
|---|---|
| PubChem CID | 124818969 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N-[[(3S,3aR,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-cyclopropylacetamide |
| SMILES | CN(C)c1cc(N2C[C@H]3[C@@H](CNC(=O)CC4CC4)CO[C@H]3C2)ncn1 |
| InChI | InChI=1S/C18H27N5O2/c1-22(2)16-6-17(21-11-20-16)23-8-14-13(10-25-15(14)9-23)7-19-18(24)5-12-3-4-12/h6,11-15H,3-5,7-10H2,1-2H3,(H,19,24)/t13-,14-,15-/m0/s1 |
| InChIKey | SETRBIYZTBFPDA-KKUMJFAQSA-N |
| XLogP | 0.91 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |