C18H22F3N3O5 — CID 171694849
[(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 171694849) has the molecular formula C18H22F3N3O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is [(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694849 |
| Molecular Formula | C18H22F3N3O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@H]1CO[C@@H]2CN(Cc3ccccn3)C[C@H]12)N1CCCO1 |
| InChI | InChI=1S/C16H21N3O3.C2HF3O2/c20-16(19-6-3-7-22-19)14-11-21-15-10-18(9-13(14)15)8-12-4-1-2-5-17-12;3-2(4,5)1(6)7/h1-2,4-5,13-15H,3,6-11H2;(H,6,7)/t13-,14+,15-;/m1./s1 |
| InChIKey | OGUSLFNMDOHGNP-USAYTKQKSA-N |
| XLogP | 1.33 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |