C16H21N3O3 — CID 124787633
[(3S,3aR,6aR)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 124787633) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is [(3S,3aR,6aR)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3S,3aR,6aR)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 124787633 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | [(3S,3aR,6aR)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C([C@@H]1CO[C@H]2CN(Cc3ccccn3)C[C@H]21)N1CCCO1 |
| InChI | InChI=1S/C16H21N3O3/c20-16(19-6-3-7-22-19)14-11-21-15-10-18(9-13(14)15)8-12-4-1-2-5-17-12/h1-2,4-5,13-15H,3,6-11H2/t13-,14+,15-/m0/s1 |
| InChIKey | SESTXWQARJOOQB-ZNMIVQPWSA-N |
| XLogP | 0.69 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |