C19H27N3O3 — CID 97388433
[(3R,4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(oxazinan-2-yl)methanone (PubChem CID 97388433) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is [(3R,4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(oxazinan-2-yl)methanone.
| Compound Name | [(3R,4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(oxazinan-2-yl)methanone |
|---|---|
| PubChem CID | 97388433 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [(3R,4aR,8aS)-6-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(oxazinan-2-yl)methanone |
| SMILES | O=C([C@H]1CO[C@H]2CCN(Cc3ccccn3)C[C@H]2C1)N1CCCCO1 |
| InChI | InChI=1S/C19H27N3O3/c23-19(22-8-3-4-10-25-22)16-11-15-12-21(9-6-18(15)24-14-16)13-17-5-1-2-7-20-17/h1-2,5,7,15-16,18H,3-4,6,8-14H2/t15-,16-,18+/m1/s1 |
| InChIKey | KQFIZUAMBGSOPN-NUJGCVRESA-N |
| XLogP | 1.86 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |