C18H30N2O4 — CID 133141646
[(3R,4aR,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 133141646) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(3R,4aR,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3R,4aR,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 133141646 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [(3R,4aR,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-3-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C([C@H]1CO[C@H]2CCN(CC3CCOCC3)C[C@H]2C1)N1CCCO1 |
| InChI | InChI=1S/C18H30N2O4/c21-18(20-5-1-7-24-20)16-10-15-12-19(6-2-17(15)23-13-16)11-14-3-8-22-9-4-14/h14-17H,1-13H2/t15-,16-,17+/m1/s1 |
| InChIKey | XGHNXWRZFBAMJN-ZACQAIPSSA-N |
| XLogP | 1.30 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |