C20H23F6N3O7 — CID 155844951
[(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155844951) has the molecular formula C20H23F6N3O7 and a molecular weight of 531.41 g/mol. Its IUPAC name is [(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155844951 |
| Molecular Formula | C20H23F6N3O7 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | [(3R,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-(1,2-oxazolidin-2-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C([C@H]1CO[C@@H]2CN(Cc3ccccn3)C[C@H]12)N1CCCO1 |
| InChI | InChI=1S/C16H21N3O3.2C2HF3O2/c20-16(19-6-3-7-22-19)14-11-21-15-10-18(9-13(14)15)8-12-4-1-2-5-17-12;2*3-2(4,5)1(6)7/h1-2,4-5,13-15H,3,6-11H2;2*(H,6,7)/t13-,14+,15-;;/m1../s1 |
| InChIKey | UAUFNTXAMHCABA-ISUJJMBGSA-N |
| XLogP | 1.96 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |