C21H25F3N2O4S — CID 155849841
1-[(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(1-benzothiophen-3-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155849841) has the molecular formula C21H25F3N2O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-[(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(1-benzothiophen-3-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(1-benzothiophen-3-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849841 |
| Molecular Formula | C21H25F3N2O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-[(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(1-benzothiophen-3-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C[C@@H]1CO[C@@H]2CN(C(=O)Cc3csc4ccccc34)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N2O2S.C2HF3O2/c1-20(2)8-14-11-23-17-10-21(9-16(14)17)19(22)7-13-12-24-18-6-4-3-5-15(13)18;3-2(4,5)1(6)7/h3-6,12,14,16-17H,7-11H2,1-2H3;(H,6,7)/t14-,16-,17-;/m1./s1 |
| InChIKey | MVZVPBXYMQKDCR-XJEXWWMKSA-N |
| XLogP | 3.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |