C14H13NO3S — CID 51087745
1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 51087745) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 51087745 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(Cc2csc3ccccc23)C1 |
| InChI | InChI=1S/C14H13NO3S/c16-13-5-9(14(17)18)6-15(13)7-10-8-19-12-4-2-1-3-11(10)12/h1-4,8-9H,5-7H2,(H,17,18) |
| InChIKey | FXBSWBHNUVYUBS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |