C14H14ClNO3S2 — CID 168673840
[1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673840) has the molecular formula C14H14ClNO3S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is [1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673840 |
| Molecular Formula | C14H14ClNO3S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | [1-(1-benzothiophen-3-ylmethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H14ClNO3S2/c15-21(18,19)9-10-5-14(17)16(6-10)7-11-8-20-13-4-2-1-3-12(11)13/h1-4,8,10H,5-7,9H2 |
| InChIKey | QPWTWVKQXJKVKT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |