C20H28F3NO4 — CID 155828825
(3R,3aR,6aR)-5-[(2,5-dimethylphenyl)methyl]-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155828825) has the molecular formula C20H28F3NO4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (3R,3aR,6aR)-5-[(2,5-dimethylphenyl)methyl]-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aR)-5-[(2,5-dimethylphenyl)methyl]-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828825 |
| Molecular Formula | C20H28F3NO4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (3R,3aR,6aR)-5-[(2,5-dimethylphenyl)methyl]-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COCC[C@H]1CO[C@H]2CN(Cc3cc(C)ccc3C)C[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27NO2.C2HF3O2/c1-13-4-5-14(2)16(8-13)9-19-10-17-15(6-7-20-3)12-21-18(17)11-19;3-2(4,5)1(6)7/h4-5,8,15,17-18H,6-7,9-12H2,1-3H3;(H,6,7)/t15-,17-,18-;/m0./s1 |
| InChIKey | RLYKGICXKDJRFW-OOAIBONUSA-N |
| XLogP | 3.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |