C19H25F3N2O4S — CID 155848131
1-[[(3R,3aS,6aS)-5-[(3-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155848131) has the molecular formula C19H25F3N2O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 1-[[(3R,3aS,6aS)-5-[(3-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[[(3R,3aS,6aS)-5-[(3-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848131 |
| Molecular Formula | C19H25F3N2O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[[(3R,3aS,6aS)-5-[(3-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccsc1CN1C[C@@H]2[C@H](CN3CCCC3=O)CO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2O2S.C2HF3O2/c1-12-4-6-22-16(12)10-18-8-14-13(11-21-15(14)9-18)7-19-5-2-3-17(19)20;3-2(4,5)1(6)7/h4,6,13-15H,2-3,5,7-11H2,1H3;(H,6,7)/t13-,14-,15-;/m1./s1 |
| InChIKey | OBZZGJFTHSBUCP-RFMLDLTKSA-N |
| XLogP | 2.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |