C18H22ClFN2O2 — CID 124806695
1-[[(3R,3aR,6aR)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one (PubChem CID 124806695) has the molecular formula C18H22ClFN2O2 and a molecular weight of 352.84 g/mol. Its IUPAC name is 1-[[(3R,3aR,6aR)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[(3R,3aR,6aR)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 124806695 |
| Molecular Formula | C18H22ClFN2O2 |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[[(3R,3aR,6aR)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@@H]1CO[C@H]2CN(Cc3ccc(Cl)c(F)c3)C[C@@H]12 |
| InChI | InChI=1S/C18H22ClFN2O2/c19-15-4-3-12(6-16(15)20)7-21-9-14-13(11-24-17(14)10-21)8-22-5-1-2-18(22)23/h3-4,6,13-14,17H,1-2,5,7-11H2/t13-,14+,17+/m1/s1 |
| InChIKey | RSSDRPKUQZXHSR-KEYYUXOJSA-N |
| XLogP | 2.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |