C18H18ClFN2O3 — CID 124916197
[(4aS,7aR)-6-[(4-chloro-3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-(furan-2-yl)methanone (PubChem CID 124916197) has the molecular formula C18H18ClFN2O3 and a molecular weight of 364.80 g/mol. Its IUPAC name is [(4aS,7aR)-6-[(4-chloro-3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-(furan-2-yl)methanone.
| Compound Name | [(4aS,7aR)-6-[(4-chloro-3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 124916197 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [(4aS,7aR)-6-[(4-chloro-3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCO[C@@H]2CN(Cc3ccc(Cl)c(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C18H18ClFN2O3/c19-13-4-3-12(8-14(13)20)9-21-10-15-17(11-21)25-7-5-22(15)18(23)16-2-1-6-24-16/h1-4,6,8,15,17H,5,7,9-11H2/t15-,17+/m0/s1 |
| InChIKey | OGACWVYAWCYGOA-DOTOQJQBSA-N |
| XLogP | 2.80 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |