C15H18ClFN2O2 — CID 124790059
(5aS,9aS)-8-[(4-chloro-3-fluorophenyl)methyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 124790059) has the molecular formula C15H18ClFN2O2 and a molecular weight of 312.77 g/mol. Its IUPAC name is (5aS,9aS)-8-[(4-chloro-3-fluorophenyl)methyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aS,9aS)-8-[(4-chloro-3-fluorophenyl)methyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 124790059 |
| Molecular Formula | C15H18ClFN2O2 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (5aS,9aS)-8-[(4-chloro-3-fluorophenyl)methyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1NCCO[C@@H]2CN(Cc3ccc(Cl)c(F)c3)CC[C@H]12 |
| InChI | InChI=1S/C15H18ClFN2O2/c16-12-2-1-10(7-13(12)17)8-19-5-3-11-14(9-19)21-6-4-18-15(11)20/h1-2,7,11,14H,3-6,8-9H2,(H,18,20)/t11-,14+/m0/s1 |
| InChIKey | KRUMHEZRLPAKSX-SMDDNHRTSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |