C14H15ClFN3 — CID 95846034
5-[(3S)-1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-3-yl]-1H-pyrazole (PubChem CID 95846034) has the molecular formula C14H15ClFN3 and a molecular weight of 279.75 g/mol. Its IUPAC name is 5-[(3S)-1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-3-yl]-1H-pyrazole.
| Compound Name | 5-[(3S)-1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-3-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 95846034 |
| Molecular Formula | C14H15ClFN3 |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-[(3S)-1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-3-yl]-1H-pyrazole |
| SMILES | Fc1cc(CN2CC[C@H](c3ccn[nH]3)C2)ccc1Cl |
| InChI | InChI=1S/C14H15ClFN3/c15-12-2-1-10(7-13(12)16)8-19-6-4-11(9-19)14-3-5-17-18-14/h1-3,5,7,11H,4,6,8-9H2,(H,17,18)/t11-/m0/s1 |
| InChIKey | GAUMFFRGEWBDAV-NSHDSACASA-N |
| XLogP | 3.19 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |