C18H26N2O2 — CID 98896784
1-[(4aS,8aS)-6-[(3,4-dimethylphenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone (PubChem CID 98896784) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[(4aS,8aS)-6-[(3,4-dimethylphenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone.
| Compound Name | 1-[(4aS,8aS)-6-[(3,4-dimethylphenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 98896784 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[(4aS,8aS)-6-[(3,4-dimethylphenyl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@H]2CCN(Cc3ccc(C)c(C)c3)C[C@@H]21 |
| InChI | InChI=1S/C18H26N2O2/c1-13-4-5-16(10-14(13)2)11-19-7-6-18-17(12-19)20(15(3)21)8-9-22-18/h4-5,10,17-18H,6-9,11-12H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | GALYKZVUCVQQJF-ROUUACIJSA-N |
| XLogP | 2.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |