C16H22FN3O2 — CID 124798531
2-[(4aS,7aR)-6-[(3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide (PubChem CID 124798531) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[(4aS,7aR)-6-[(3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide.
| Compound Name | 2-[(4aS,7aR)-6-[(3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 124798531 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-[(4aS,7aR)-6-[(3-fluorophenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCO[C@@H]2CN(Cc3cccc(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C16H22FN3O2/c1-18-16(21)11-20-5-6-22-15-10-19(9-14(15)20)8-12-3-2-4-13(17)7-12/h2-4,7,14-15H,5-6,8-11H2,1H3,(H,18,21)/t14-,15+/m0/s1 |
| InChIKey | AFOLZZRKMVJHBE-LSDHHAIUSA-N |
| XLogP | 0.46 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |