C13H19N5O2 — CID 124802555
2-[(4aS,7aR)-6-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide (PubChem CID 124802555) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-[(4aS,7aR)-6-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide.
| Compound Name | 2-[(4aS,7aR)-6-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 124802555 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(4aS,7aR)-6-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCO[C@@H]2CN(c3cnccn3)C[C@@H]21 |
| InChI | InChI=1S/C13H19N5O2/c1-14-13(19)9-17-4-5-20-11-8-18(7-10(11)17)12-6-15-2-3-16-12/h2-3,6,10-11H,4-5,7-9H2,1H3,(H,14,19)/t10-,11+/m0/s1 |
| InChIKey | PGUOCSAFKGCMLF-WDEREUQCSA-N |
| XLogP | -0.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |