C17H19N5O3 — CID 155877847
[(4aS,7aS)-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-methoxy-3-pyridinyl)methanone (PubChem CID 155877847) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is [(4aS,7aS)-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-methoxy-3-pyridinyl)methanone.
| Compound Name | [(4aS,7aS)-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 155877847 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [(4aS,7aS)-4-pyrazin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-methoxy-3-pyridinyl)methanone |
| SMILES | COc1ccc(C(=O)N2C[C@@H]3OCCN(c4cnccn4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C17H19N5O3/c1-24-16-3-2-12(8-20-16)17(23)21-10-13-14(11-21)25-7-6-22(13)15-9-18-4-5-19-15/h2-5,8-9,13-14H,6-7,10-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | QWNKONSBBRCBMU-KBPBESRZSA-N |
| XLogP | 0.61 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |