C15H16N4O3 — CID 155877289
[(4aS,7aS)-4-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1,3-oxazol-5-yl)methanone (PubChem CID 155877289) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is [(4aS,7aS)-4-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1,3-oxazol-5-yl)methanone.
| Compound Name | [(4aS,7aS)-4-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 155877289 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(4aS,7aS)-4-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnco1)N1C[C@@H]2OCCN(c3ccccn3)[C@H]2C1 |
| InChI | InChI=1S/C15H16N4O3/c20-15(12-7-16-10-22-12)18-8-11-13(9-18)21-6-5-19(11)14-3-1-2-4-17-14/h1-4,7,10-11,13H,5-6,8-9H2/t11-,13-/m0/s1 |
| InChIKey | OMFAEKLANYFAJL-AAEUAGOBSA-N |
| XLogP | 0.80 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |