C13H12N2O2 — CID 96587626
3,4-dihydro-1H-isoquinolin-2-yl(1,3-oxazol-5-yl)methanone (PubChem CID 96587626) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl(1,3-oxazol-5-yl)methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 96587626 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl(1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnco1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H12N2O2/c16-13(12-7-14-9-17-12)15-6-5-10-3-1-2-4-11(10)8-15/h1-4,7,9H,5-6,8H2 |
| InChIKey | UPWIKWYBNZDPEM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |