C20H18FN3O3 — CID 92598325
[(2R)-2-(6-fluoroisoquinolin-3-yl)morpholin-4-yl]-(6-methoxy-3-pyridinyl)methanone (PubChem CID 92598325) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is [(2R)-2-(6-fluoroisoquinolin-3-yl)morpholin-4-yl]-(6-methoxy-3-pyridinyl)methanone.
| Compound Name | [(2R)-2-(6-fluoroisoquinolin-3-yl)morpholin-4-yl]-(6-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 92598325 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [(2R)-2-(6-fluoroisoquinolin-3-yl)morpholin-4-yl]-(6-methoxy-3-pyridinyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCO[C@@H](c3cc4cc(F)ccc4cn3)C2)cn1 |
| InChI | InChI=1S/C20H18FN3O3/c1-26-19-5-3-14(11-23-19)20(25)24-6-7-27-18(12-24)17-9-15-8-16(21)4-2-13(15)10-22-17/h2-5,8-11,18H,6-7,12H2,1H3/t18-/m1/s1 |
| InChIKey | QWNRZANGFPCGGW-GOSISDBHSA-N |
| XLogP | 2.99 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |