C17H24N2O2S — CID 97364888
(2S,3aS,7aR)-N-cyclobutyl-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 97364888) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is (2S,3aS,7aR)-N-cyclobutyl-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2S,3aS,7aR)-N-cyclobutyl-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97364888 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2S,3aS,7aR)-N-cyclobutyl-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCC1)[C@@H]1C[C@@H]2CCN(Cc3ccsc3)C[C@@H]2O1 |
| InChI | InChI=1S/C17H24N2O2S/c20-17(18-14-2-1-3-14)15-8-13-4-6-19(10-16(13)21-15)9-12-5-7-22-11-12/h5,7,11,13-16H,1-4,6,8-10H2,(H,18,20)/t13-,15-,16-/m0/s1 |
| InChIKey | NEFVUXUCLAAUHF-BPUTZDHNSA-N |
| XLogP | 2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |