C21H27F3N2O4 — CID 155850095
(2S,3aS,7aS)-N-cyclopropyl-6-[(3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155850095) has the molecular formula C21H27F3N2O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is (2S,3aS,7aS)-N-cyclopropyl-6-[(3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aS,7aS)-N-cyclopropyl-6-[(3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155850095 |
| Molecular Formula | C21H27F3N2O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2S,3aS,7aS)-N-cyclopropyl-6-[(3-methylphenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc(CN2CC[C@H]3C[C@@H](C(=O)NC4CC4)O[C@@H]3C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N2O2.C2HF3O2/c1-13-3-2-4-14(9-13)11-21-8-7-15-10-17(23-18(15)12-21)19(22)20-16-5-6-16;3-2(4,5)1(6)7/h2-4,9,15-18H,5-8,10-12H2,1H3,(H,20,22);(H,6,7)/t15-,17-,18+;/m0./s1 |
| InChIKey | VDZAHXMMMNERSZ-TZQBAMPOSA-N |
| XLogP | 2.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |