C19H28N2O2S — CID 97366740
[(2S,3aS,7aS)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 97366740) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is [(2S,3aS,7aS)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(2S,3aS,7aS)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 97366740 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(2S,3aS,7aS)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)[C@@H]2C[C@@H]3CCN(Cc4ccsc4)C[C@H]3O2)CC1 |
| InChI | InChI=1S/C19H28N2O2S/c1-14-2-7-21(8-3-14)19(22)17-10-16-4-6-20(12-18(16)23-17)11-15-5-9-24-13-15/h5,9,13-14,16-18H,2-4,6-8,10-12H2,1H3/t16-,17-,18+/m0/s1 |
| InChIKey | BCJLSILNLQNHII-OKZBNKHCSA-N |
| XLogP | 2.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |