C19H29N3O3 — CID 98811452
[(2R,3aS,7aS)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 98811452) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(2R,3aS,7aS)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(2R,3aS,7aS)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 98811452 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(2R,3aS,7aS)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(CN2CC[C@H]3C[C@H](C(=O)N4CCC(C)CC4)O[C@@H]3C2)no1 |
| InChI | InChI=1S/C19H29N3O3/c1-13-3-7-22(8-4-13)19(23)17-10-15-5-6-21(12-18(15)24-17)11-16-9-14(2)25-20-16/h9,13,15,17-18H,3-8,10-12H2,1-2H3/t15-,17+,18+/m0/s1 |
| InChIKey | BHRQXKPFNYGYHR-CGTJXYLNSA-N |
| XLogP | 2.22 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |