C21H28F2N2O2 — CID 155878543
[(2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 155878543) has the molecular formula C21H28F2N2O2 and a molecular weight of 378.46 g/mol. Its IUPAC name is [(2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 155878543 |
| Molecular Formula | C21H28F2N2O2 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | [(2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)[C@H]2C[C@@H]3CCN(Cc4ccc(F)c(F)c4)C[C@H]3O2)CC1 |
| InChI | InChI=1S/C21H28F2N2O2/c1-14-4-8-25(9-5-14)21(26)19-11-16-6-7-24(13-20(16)27-19)12-15-2-3-17(22)18(23)10-15/h2-3,10,14,16,19-20H,4-9,11-13H2,1H3/t16-,19+,20+/m0/s1 |
| InChIKey | GFIINZVVJAPBJP-PWIZWCRZSA-N |
| XLogP | 3.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |