C21H28F2N2O3 — CID 155878653
(2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 155878653) has the molecular formula C21H28F2N2O3 and a molecular weight of 394.46 g/mol. Its IUPAC name is (2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155878653 |
| Molecular Formula | C21H28F2N2O3 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (2R,3aS,7aS)-6-[(3,4-difluorophenyl)methyl]-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCOCC1)[C@H]1C[C@@H]2CCN(Cc3ccc(F)c(F)c3)C[C@H]2O1 |
| InChI | InChI=1S/C21H28F2N2O3/c22-17-2-1-15(9-18(17)23)12-25-6-3-16-10-19(28-20(16)13-25)21(26)24-11-14-4-7-27-8-5-14/h1-2,9,14,16,19-20H,3-8,10-13H2,(H,24,26)/t16-,19+,20+/m0/s1 |
| InChIKey | AHYGXTQJXIYYKD-PWIZWCRZSA-N |
| XLogP | 2.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |