C19H32N2O4 — CID 97366930
(2R,3aS,7aR)-6-(oxan-4-yl)-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 97366930) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2R,3aS,7aR)-6-(oxan-4-yl)-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2R,3aS,7aR)-6-(oxan-4-yl)-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97366930 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2R,3aS,7aR)-6-(oxan-4-yl)-N-(oxan-4-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCOCC1)[C@H]1C[C@@H]2CCN(C3CCOCC3)C[C@@H]2O1 |
| InChI | InChI=1S/C19H32N2O4/c22-19(20-12-14-2-7-23-8-3-14)17-11-15-1-6-21(13-18(15)25-17)16-4-9-24-10-5-16/h14-18H,1-13H2,(H,20,22)/t15-,17+,18-/m0/s1 |
| InChIKey | ULUNZQUSLPPCBX-JQHSSLGASA-N |
| XLogP | 1.19 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |