C18H26N2O2S — CID 97366557
(2R,3aS,7aS)-6-cyclopentyl-N-(thiophen-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 97366557) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is (2R,3aS,7aS)-6-cyclopentyl-N-(thiophen-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2R,3aS,7aS)-6-cyclopentyl-N-(thiophen-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97366557 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2R,3aS,7aS)-6-cyclopentyl-N-(thiophen-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@H]1C[C@@H]2CCN(C3CCCC3)C[C@H]2O1 |
| InChI | InChI=1S/C18H26N2O2S/c21-18(19-11-15-6-3-9-23-15)16-10-13-7-8-20(12-17(13)22-16)14-4-1-2-5-14/h3,6,9,13-14,16-17H,1-2,4-5,7-8,10-12H2,(H,19,21)/t13-,16+,17+/m0/s1 |
| InChIKey | WQWHUEGMFLBVOU-IAOVAPTHSA-N |
| XLogP | 2.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |