C25H33F6N3O6 — CID 155828156
(2R,3aS,7aS)-6-cyclohexyl-N-(2-pyridin-2-ylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828156) has the molecular formula C25H33F6N3O6 and a molecular weight of 585.54 g/mol. Its IUPAC name is (2R,3aS,7aS)-6-cyclohexyl-N-(2-pyridin-2-ylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2R,3aS,7aS)-6-cyclohexyl-N-(2-pyridin-2-ylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828156 |
| Molecular Formula | C25H33F6N3O6 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | (2R,3aS,7aS)-6-cyclohexyl-N-(2-pyridin-2-ylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NCCc1ccccn1)[C@H]1C[C@@H]2CCN(C3CCCCC3)C[C@H]2O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H31N3O2.2C2HF3O2/c25-21(23-12-9-17-6-4-5-11-22-17)19-14-16-10-13-24(15-20(16)26-19)18-7-2-1-3-8-18;2*3-2(4,5)1(6)7/h4-6,11,16,18-20H,1-3,7-10,12-15H2,(H,23,25);2*(H,6,7)/t16-,19+,20+;;/m0../s1 |
| InChIKey | RINMMEUGHWGWOY-NCDQRYANSA-N |
| XLogP | 3.82 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |