C17H24N2O2S — CID 97474234
2-[(2S,3aS,6aS)-5-cyclobutyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 97474234) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-[(2S,3aS,6aS)-5-cyclobutyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(2S,3aS,6aS)-5-cyclobutyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 97474234 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[(2S,3aS,6aS)-5-cyclobutyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2CN(C3CCC3)C[C@H]2O1)NCc1cccs1 |
| InChI | InChI=1S/C17H24N2O2S/c20-17(18-9-15-5-2-6-22-15)8-14-7-12-10-19(11-16(12)21-14)13-3-1-4-13/h2,5-6,12-14,16H,1,3-4,7-11H2,(H,18,20)/t12-,14-,16+/m0/s1 |
| InChIKey | GWVCDAMJIYLDGM-DUVNUKRYSA-N |
| XLogP | 2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |