C19H27N3O3 — CID 97474317
2-[(2S,3aS,6aS)-5-(oxan-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 97474317) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[(2S,3aS,6aS)-5-(oxan-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(2S,3aS,6aS)-5-(oxan-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 97474317 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-[(2S,3aS,6aS)-5-(oxan-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2CN(C3CCOCC3)C[C@H]2O1)NCc1cccnc1 |
| InChI | InChI=1S/C19H27N3O3/c23-19(21-11-14-2-1-5-20-10-14)9-17-8-15-12-22(13-18(15)25-17)16-3-6-24-7-4-16/h1-2,5,10,15-18H,3-4,6-9,11-13H2,(H,21,23)/t15-,17-,18+/m0/s1 |
| InChIKey | XWZKCMLPESPYNH-RYQLBKOJSA-N |
| XLogP | 1.36 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |