C20H26N4O2 — CID 124781326
(4R)-2-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide (PubChem CID 124781326) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (4R)-2-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide.
| Compound Name | (4R)-2-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 124781326 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (4R)-2-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1CN(C2CCOCC2)Cc2cccn2C1 |
| InChI | InChI=1S/C20H26N4O2/c25-20(22-12-16-3-1-7-21-11-16)17-13-23-8-2-4-19(23)15-24(14-17)18-5-9-26-10-6-18/h1-4,7-8,11,17-18H,5-6,9-10,12-15H2,(H,22,25)/t17-/m0/s1 |
| InChIKey | FFNAGIPAMYRGHD-KRWDZBQOSA-N |
| XLogP | 1.81 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |