C19H28N2O2S — CID 124787514
2-[(1S,3aS,7aS)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 124787514) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-[(1S,3aS,7aS)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[(1S,3aS,7aS)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 124787514 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(1S,3aS,7aS)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(C[C@@H]1OC[C@@H]2CN(C3CCC3)CC[C@@H]21)NCCc1cccs1 |
| InChI | InChI=1S/C19H28N2O2S/c22-19(20-8-6-16-5-2-10-24-16)11-18-17-7-9-21(15-3-1-4-15)12-14(17)13-23-18/h2,5,10,14-15,17-18H,1,3-4,6-9,11-13H2,(H,20,22)/t14-,17-,18-/m0/s1 |
| InChIKey | QZEAVXCOFQPMIW-WBAXXEDZSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |