C16H25N3O4 — CID 124798124
(2S,3aR,7aR)-N-(2-methoxyethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 124798124) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2S,3aR,7aR)-N-(2-methoxyethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2S,3aR,7aR)-N-(2-methoxyethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124798124 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (2S,3aR,7aR)-N-(2-methoxyethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H]2CCN(Cc3cc(C)on3)C[C@@H]2O1 |
| InChI | InChI=1S/C16H25N3O4/c1-11-7-13(18-23-11)9-19-5-3-12-8-14(22-15(12)10-19)16(20)17-4-6-21-2/h7,12,14-15H,3-6,8-10H2,1-2H3,(H,17,20)/t12-,14+,15+/m1/s1 |
| InChIKey | KMDCUXSKSQYMNB-SNPRPXQTSA-N |
| XLogP | 0.73 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|