C21H21F6N5O6 — CID 127023374
(2S,3aS,6aS)-N-(pyridin-3-ylmethyl)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023374) has the molecular formula C21H21F6N5O6 and a molecular weight of 553.42 g/mol. Its IUPAC name is (2S,3aS,6aS)-N-(pyridin-3-ylmethyl)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,3aS,6aS)-N-(pyridin-3-ylmethyl)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023374 |
| Molecular Formula | C21H21F6N5O6 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | (2S,3aS,6aS)-N-(pyridin-3-ylmethyl)-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NCc1cccnc1)[C@@H]1C[C@H]2[C@H](CCN2c2ncccn2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19N5O2.2C2HF3O2/c23-16(21-11-12-3-1-5-18-10-12)15-9-13-14(24-15)4-8-22(13)17-19-6-2-7-20-17;2*3-2(4,5)1(6)7/h1-3,5-7,10,13-15H,4,8-9,11H2,(H,21,23);2*(H,6,7)/t13-,14-,15-;;/m0../s1 |
| InChIKey | ABECEJKAFMQYBO-VZXRKJOKSA-N |
| XLogP | 2.19 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |