C22H23F6N3O7 — CID 155837119
(3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155837119) has the molecular formula C22H23F6N3O7 and a molecular weight of 555.43 g/mol. Its IUPAC name is (3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155837119 |
| Molecular Formula | C22H23F6N3O7 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(Nc1cccnc1)[C@@H]1CC[C@@H]2[C@@H](CCN2Cc2ccco2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O3.2C2HF3O2/c22-18(20-13-3-1-8-19-11-13)17-6-5-15-16(24-17)7-9-21(15)12-14-4-2-10-23-14;2*3-2(4,5)1(6)7/h1-4,8,10-11,15-17H,5-7,9,12H2,(H,20,22);2*(H,6,7)/t15-,16-,17+;;/m1../s1 |
| InChIKey | VPLDBRFHSRIZNH-HREQYLLUSA-N |
| XLogP | 3.70 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |