C14H19N3O4S — CID 98811031
(3aR,5S,7aR)-1-methylsulfonyl-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 98811031) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is (3aR,5S,7aR)-1-methylsulfonyl-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5S,7aR)-1-methylsulfonyl-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 98811031 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (3aR,5S,7aR)-1-methylsulfonyl-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CC[C@H]2O[C@H](C(=O)Nc3cccnc3)CC[C@H]21 |
| InChI | InChI=1S/C14H19N3O4S/c1-22(19,20)17-8-6-12-11(17)4-5-13(21-12)14(18)16-10-3-2-7-15-9-10/h2-3,7,9,11-13H,4-6,8H2,1H3,(H,16,18)/t11-,12-,13+/m1/s1 |
| InChIKey | MYGHKIMIXURBJA-UPJWGTAASA-N |
| XLogP | 0.60 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |