C14H20N2O5S — CID 124783956
(3aS,5S,7aS)-N-(furan-2-ylmethyl)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 124783956) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is (3aS,5S,7aS)-N-(furan-2-ylmethyl)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aS,5S,7aS)-N-(furan-2-ylmethyl)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 124783956 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (3aS,5S,7aS)-N-(furan-2-ylmethyl)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CC[C@@H]2O[C@H](C(=O)NCc3ccco3)CC[C@@H]21 |
| InChI | InChI=1S/C14H20N2O5S/c1-22(18,19)16-7-6-12-11(16)4-5-13(21-12)14(17)15-9-10-3-2-8-20-10/h2-3,8,11-13H,4-7,9H2,1H3,(H,15,17)/t11-,12-,13-/m0/s1 |
| InChIKey | WFMSMERIRFQELC-AVGNSLFASA-N |
| XLogP | 0.48 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |