C20H23F3N2O5S — CID 155865577
(3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155865577) has the molecular formula C20H23F3N2O5S and a molecular weight of 460.47 g/mol. Its IUPAC name is (3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155865577 |
| Molecular Formula | C20H23F3N2O5S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (3aR,5S,7aR)-1-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cccs1)[C@@H]1CC[C@@H]2[C@@H](CCN2Cc2ccco2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O3S.C2HF3O2/c21-18(19-11-14-4-2-10-24-14)17-6-5-15-16(23-17)7-8-20(15)12-13-3-1-9-22-13;3-2(4,5)1(6)7/h1-4,9-10,15-17H,5-8,11-12H2,(H,19,21);(H,6,7)/t15-,16-,17+;/m1./s1 |
| InChIKey | QIVAXFXEVDUBLK-QEFLZESTSA-N |
| XLogP | 3.41 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |