C21H25F5N2O3 — CID 155869904
(3aS,6aS)-1-[(3,3-difluorocyclobutyl)methyl]-4-[(4-methylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155869904) has the molecular formula C21H25F5N2O3 and a molecular weight of 448.43 g/mol. Its IUPAC name is (3aS,6aS)-1-[(3,3-difluorocyclobutyl)methyl]-4-[(4-methylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aS)-1-[(3,3-difluorocyclobutyl)methyl]-4-[(4-methylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869904 |
| Molecular Formula | C21H25F5N2O3 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (3aS,6aS)-1-[(3,3-difluorocyclobutyl)methyl]-4-[(4-methylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C(=O)C[C@H]3[C@@H]2CCN3CC2CC(F)(F)C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24F2N2O.C2HF3O2/c1-13-2-4-14(5-3-13)12-23-16-6-7-22(17(16)8-18(23)24)11-15-9-19(20,21)10-15;3-2(4,5)1(6)7/h2-5,15-17H,6-12H2,1H3;(H,6,7)/t16-,17-;/m0./s1 |
| InChIKey | MCADLGLWPBWYMZ-QJHJCNPRSA-N |
| XLogP | 3.85 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |