C22H27F5N2O3 — CID 155864653
(3aS,6aS)-1-(cyclohexylmethyl)-4-[(2,3-difluorophenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155864653) has the molecular formula C22H27F5N2O3 and a molecular weight of 462.46 g/mol. Its IUPAC name is (3aS,6aS)-1-(cyclohexylmethyl)-4-[(2,3-difluorophenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aS)-1-(cyclohexylmethyl)-4-[(2,3-difluorophenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864653 |
| Molecular Formula | C22H27F5N2O3 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (3aS,6aS)-1-(cyclohexylmethyl)-4-[(2,3-difluorophenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1C[C@H]2[C@H](CCN2CC2CCCCC2)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C20H26F2N2O.C2HF3O2/c21-16-8-4-7-15(20(16)22)13-24-17-9-10-23(18(17)11-19(24)25)12-14-5-2-1-3-6-14;3-2(4,5)1(6)7/h4,7-8,14,17-18H,1-3,5-6,9-13H2;(H,6,7)/t17-,18-;/m0./s1 |
| InChIKey | MWFLXESZYPASGS-APTPAJQOSA-N |
| XLogP | 4.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |