C21H23F3N2O5 — CID 155848742
[(4aS,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155848742) has the molecular formula C21H23F3N2O5 and a molecular weight of 440.42 g/mol. Its IUPAC name is [(4aS,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848742 |
| Molecular Formula | C21H23F3N2O5 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [(4aS,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCO[C@H]1CC[C@H]2[C@H]1OCCN2C(=O)c1ccc2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N2O3.C2HF3O2/c1-2-23-17-10-9-16-18(17)24-12-11-21(16)19(22)15-8-7-13-5-3-4-6-14(13)20-15;3-2(4,5)1(6)7/h3-8,16-18H,2,9-12H2,1H3;(H,6,7)/t16-,17-,18+;/m0./s1 |
| InChIKey | VRYXMSLXOUQPGU-WSLRHHBVSA-N |
| XLogP | 3.28 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |