C20H21F3N2O5 — CID 155841408
[(4aS,7R,7aR)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155841408) has the molecular formula C20H21F3N2O5 and a molecular weight of 426.39 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7R,7aR)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841408 |
| Molecular Formula | C20H21F3N2O5 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [(4aS,7R,7aR)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CC[C@H]2[C@H]1OCCN2C(=O)c1ccnc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N2O3.C2HF3O2/c1-22-16-7-6-15-17(16)23-11-10-20(15)18(21)13-8-9-19-14-5-3-2-4-12(13)14;3-2(4,5)1(6)7/h2-5,8-9,15-17H,6-7,10-11H2,1H3;(H,6,7)/t15-,16+,17+;/m0./s1 |
| InChIKey | WQCQYXLAOKDCNK-NINZUIERSA-N |
| XLogP | 2.89 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |