C19H21NO3 — CID 124792115
[(4aR,7R,7aS)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-naphthalen-2-ylmethanone (PubChem CID 124792115) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(4aR,7R,7aS)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(4aR,7R,7aS)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 124792115 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(4aR,7R,7aS)-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-naphthalen-2-ylmethanone |
| SMILES | CO[C@@H]1CC[C@@H]2[C@@H]1OCCN2C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H21NO3/c1-22-17-9-8-16-18(17)23-11-10-20(16)19(21)15-7-6-13-4-2-3-5-14(13)12-15/h2-7,12,16-18H,8-11H2,1H3/t16-,17-,18+/m1/s1 |
| InChIKey | RMBHTUIXJGXZMQ-KURKYZTESA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |