C17H19NO4 — CID 124788545
[(3aR,7R,7aR)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(1-benzofuran-2-yl)methanone (PubChem CID 124788545) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(3aR,7R,7aR)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(1-benzofuran-2-yl)methanone.
| Compound Name | [(3aR,7R,7aR)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 124788545 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [(3aR,7R,7aR)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(1-benzofuran-2-yl)methanone |
| SMILES | CO[C@@H]1CCN(C(=O)c2cc3ccccc3o2)[C@@H]2CCO[C@H]21 |
| InChI | InChI=1S/C17H19NO4/c1-20-14-6-8-18(12-7-9-21-16(12)14)17(19)15-10-11-4-2-3-5-13(11)22-15/h2-5,10,12,14,16H,6-9H2,1H3/t12-,14-,16-/m1/s1 |
| InChIKey | BUAWDMHHWXYXTO-XNRPHZJLSA-N |
| XLogP | 2.45 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |