C19H23NO5 — CID 134690177
[(4aR,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-methoxy-1-benzofuran-2-yl)methanone (PubChem CID 134690177) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [(4aR,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-methoxy-1-benzofuran-2-yl)methanone.
| Compound Name | [(4aR,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-methoxy-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 134690177 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(4aR,7S,7aR)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-methoxy-1-benzofuran-2-yl)methanone |
| SMILES | CCO[C@H]1CC[C@@H]2[C@H]1OCCN2C(=O)c1cc2cccc(OC)c2o1 |
| InChI | InChI=1S/C19H23NO5/c1-3-23-15-8-7-13-18(15)24-10-9-20(13)19(21)16-11-12-5-4-6-14(22-2)17(12)25-16/h4-6,11,13,15,18H,3,7-10H2,1-2H3/t13-,15+,18-/m1/s1 |
| InChIKey | SMDASVHPJJAXQZ-QIIPPGSGSA-N |
| XLogP | 2.85 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |