C19H22N2O3 — CID 124826721
[(4aR,7R,7aS)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone (PubChem CID 124826721) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is [(4aR,7R,7aS)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone.
| Compound Name | [(4aR,7R,7aS)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 124826721 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [(4aR,7R,7aS)-7-ethoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-quinolin-2-ylmethanone |
| SMILES | CCO[C@@H]1CC[C@@H]2[C@@H]1OCCN2C(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-23-17-10-9-16-18(17)24-12-11-21(16)19(22)15-8-7-13-5-3-4-6-14(13)20-15/h3-8,16-18H,2,9-12H2,1H3/t16-,17-,18+/m1/s1 |
| InChIKey | UDILLNPGXRROQB-KURKYZTESA-N |
| XLogP | 2.64 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |